cas: 1256360-58-3 — see every product listed under this CAS number, including other names
N-(4-Fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzyl)cyclopropanamine 98% (CAS 1256360-58-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A734965-250mg |
| cas | 1256360-58-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 375.94 Pln | |
| Ambeed | 1g | 698.56 Pln | |
| Ambeed | 5g | 1955.69 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A734965 |
N-[[4-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]cyclopropanamine (CAS 1256360-58-3) is a chemical compound with the molecular formula C16H23BFNO2 and a molecular weight of 291.2 g/mol. IUPAC name: N-[[4-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]cyclopropanamine. InChIKey: SORDLQAKANVQLH-UHFFFAOYSA-N.
| Molecular formula | C16H23BFNO2 |
|---|---|
| Molecular weight | 291.2 g/mol |
| IUPAC name | N-[[4-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]cyclopropanamine |
| InChIKey | SORDLQAKANVQLH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)F)CNC3CC3 |
Computed by PubChem (NCBI)