cas: 81329-31-9 — see every product listed under this CAS number, including other names
N-(4-Fluorophenyl)pyrrole, 95% (CAS 81329-31-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F006341-250MG |
| cas | 81329-31-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 159.34 Pln | |
| Fluorochem | 1g | 294.71 Pln | |
| Fluorochem | 5g | 966.34 Pln | |
| Fluorochem | 25g | 4324.54 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
1-(4-fluorophenyl)pyrrole (CAS 81329-31-9) is a chemical compound with the molecular formula C10H8FN and a molecular weight of 161.18 g/mol. IUPAC name: 1-(4-fluorophenyl)pyrrole. InChIKey: YMAPGGZDHAHLGN-UHFFFAOYSA-N.
| Molecular formula | C10H8FN |
|---|---|
| Molecular weight | 161.18 g/mol |
| IUPAC name | 1-(4-fluorophenyl)pyrrole |
| InChIKey | YMAPGGZDHAHLGN-UHFFFAOYSA-N |
| SMILES | C1=CN(C=C1)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)