cas: 882679-35-8 — see every product listed under this CAS number, including other names
N-(4-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)cyclopropanecarboxamide, 97%, 97% (CAS 882679-35-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11H53X-100mg |
| cas | 882679-35-8 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 462.80 Pln | |
| Chemat | 250mg | 746.00 Pln | |
| Chemat | 1g | 2128.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
N-[4-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopropanecarboxamide (CAS 882679-35-8) is a chemical compound with the molecular formula C17H24BNO3 and a molecular weight of 301.2 g/mol. IUPAC name: N-[4-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopropanecarboxamide. InChIKey: QMVQPGMEEQHIQA-UHFFFAOYSA-N.
| Molecular formula | C17H24BNO3 |
|---|---|
| Molecular weight | 301.2 g/mol |
| IUPAC name | N-[4-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopropanecarboxamide |
| InChIKey | QMVQPGMEEQHIQA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)NC(=O)C3CC3)C |
Computed by PubChem (NCBI)