N-(5-(8-Amino-3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-2-methylphenyl)methanesulfonamide hydrochloride, 98%
cas: 2803477-07-6 — see every product listed under this CAS number, including other names
N-(5-(8-Amino-3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-2-methylphenyl)methanesulfonamide hydrochloride, 98% (CAS 2803477-07-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 25mg, 50mg, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1598456-250mg |
| cas | 2803477-07-6 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 2845.69 Pln | |
| Ambeed | 1g | 8519.44 Pln | |
| Chemat | 25mg | 496.40 Pln | |
| Chemat | 50mg | 798.80 Pln | |
| Chemat | 100mg | 1312.40 Pln | |
| Chemat | 250mg | 2560.40 Pln | |
| Chemat | 1g | 7552.40 Pln | |
| BLDpharm | 25mg | 553.16 Pln | |
| BLDpharm | 50mg | 869.72 Pln | |
| BLDpharm | 100mg | 1502.83 Pln | |
| BLDpharm | 250mg | 2791.26 Pln | |
| BLDpharm | 1g | 8361.52 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
N-[5-(8-amino-3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-2-methylphenyl]methanesulfonamide;hydrochloride (CAS 2803477-07-6) is a chemical compound with the molecular formula C14H17ClN6O2S and a molecular weight of 368.8 g/mol. IUPAC name: N-[5-(8-amino-3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-2-methylphenyl]methanesulfonamide;hydrochloride. InChIKey: SHTRNYKIKBGURX-UHFFFAOYSA-N.
| Molecular formula | C14H17ClN6O2S |
|---|---|
| Molecular weight | 368.8 g/mol |
| IUPAC name | N-[5-(8-amino-3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-2-methylphenyl]methanesulfonamide;hydrochloride |
| InChIKey | SHTRNYKIKBGURX-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C2=NN3C(=NN=C3C(=C2)N)C)NS(=O)(=O)C.Cl |
Computed by PubChem (NCBI)
Synonyms:
C14H17ClN6O2S