cas: 2096340-23-5 — see every product listed under this CAS number, including other names
N-(5-Chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzyl)cyclohexanamine 98% (CAS 2096340-23-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A932246-250mg |
| cas | 2096340-23-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 381.50 Pln | |
| Ambeed | 5g | 1010.06 Pln | |
| Ambeed | 25g | 2584.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A932246 |
N-[[5-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]cyclohexanamine (CAS 2096340-23-5) is a chemical compound with the molecular formula C19H29BClNO2 and a molecular weight of 349.7 g/mol. IUPAC name: N-[[5-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]cyclohexanamine. InChIKey: YAYRNAJXYNYNAW-UHFFFAOYSA-N.
| Molecular formula | C19H29BClNO2 |
|---|---|
| Molecular weight | 349.7 g/mol |
| IUPAC name | N-[[5-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]cyclohexanamine |
| InChIKey | YAYRNAJXYNYNAW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)Cl)CNC3CCCCC3 |
Computed by PubChem (NCBI)