cas: 140712-79-4 — see every product listed under this CAS number, including other names
N-(9-((2R,4S,5R)-4-(Bis(4-methoxyphenyl)(phenyl)methoxy)-5-(hydroxymethyl)tetrahydrofuran-2-yl)-9H-purin-6-yl)benzamide, 98%, 98% (CAS 140712-79-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112CQK-5g |
| cas | 140712-79-4 |
| size | 5g |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 5992.40 Pln | |
| Chemat | 100mg | 333.20 Pln | |
| Chemat | 250mg | 520.40 Pln | |
| Chemat | 1g | 1480.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
N-[9-[(2R,4S,5R)-4-[bis(4-methoxyphenyl)-phenylmethoxy]-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]benzamide (CAS 140712-79-4) is a chemical compound with the molecular formula C38H35N5O6 and a molecular weight of 657.7 g/mol. IUPAC name: N-[9-[(2R,4S,5R)-4-[bis(4-methoxyphenyl)-phenylmethoxy]-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]benzamide. InChIKey: LFXBQKFIXWICJR-WIHCDAFUSA-N.
| Molecular formula | C38H35N5O6 |
|---|---|
| Molecular weight | 657.7 g/mol |
| IUPAC name | N-[9-[(2R,4S,5R)-4-[bis(4-methoxyphenyl)-phenylmethoxy]-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]benzamide |
| InChIKey | LFXBQKFIXWICJR-WIHCDAFUSA-N |
| SMILES | COC1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)O[C@H]4C[C@@H](O[C@@H]4CO)N5C=NC6=C(N=CN=C65)NC(=O)C7=CC=CC=C7 |
Computed by PubChem (NCBI)