cas: 2055042-60-7 — see every product listed under this CAS number, including other names
N-(Boc-peg3)-n-bis(peg2-alcohol), 95% (CAS 2055042-60-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 50mg. Offered by: Combi-blocks, Fluorochem, Ambeed, BLDpharm.
| brand | Combi-blocks |
|---|---|
| catalog number | QW-9147-100mg |
| cas | 2055042-60-7 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 100mg | price on request | |
| Combi-blocks | 250mg | price on request | |
| Fluorochem | 1g | 3887.19 Pln | |
| Ambeed | 250mg | 1004.50 Pln | |
| Ambeed | 1g | 3802.44 Pln | |
| BLDpharm | 50mg | 392.11 Pln | |
| BLDpharm | 100mg | 603.15 Pln | |
| BLDpharm | 250mg | 1080.76 Pln | |
| BLDpharm | 1g | 4090.81 Pln | |
| Chemat | 50mg | 539.60 Pln | |
| Chemat | 100mg | 669.20 Pln | |
| Chemat | 250mg | 1226.00 Pln | |
| Chemat | 1g | 3765.20 Pln | |
| Fluorochem | 100mg | 575.86 Pln | |
| Fluorochem | 250mg | 1039.24 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
Tert-butyl N-[2-[2-[2-[2-[bis[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]amino]ethoxy]ethoxy]ethoxy]ethyl]carbamate (CAS 2055042-60-7) is a chemical compound with the molecular formula C25H52N2O11 and a molecular weight of 556.7 g/mol. IUPAC name: tert-butyl N-[2-[2-[2-[2-[bis[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]amino]ethoxy]ethoxy]ethoxy]ethyl]carbamate. InChIKey: SIKSABZCKNLIQZ-UHFFFAOYSA-N.
| Molecular formula | C25H52N2O11 |
|---|---|
| Molecular weight | 556.7 g/mol |
| IUPAC name | tert-butyl N-[2-[2-[2-[2-[bis[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]amino]ethoxy]ethoxy]ethoxy]ethyl]carbamate |
| InChIKey | SIKSABZCKNLIQZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCOCCN(CCOCCOCCO)CCOCCOCCO |
Computed by PubChem (NCBI)