cas: 2707-23-5 — see every product listed under this CAS number, including other names
N-(Chloroacetyl)-4-(trifluoromethyl)aniline, 95% (CAS 2707-23-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F008221-250MG |
| cas | 2707-23-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 122.89 Pln | |
| Fluorochem | 1g | 185.37 Pln | |
| Fluorochem | 5g | 341.56 Pln | |
| Fluorochem | 25g | 487.35 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
2-chloro-N-[4-(trifluoromethyl)phenyl]acetamide (CAS 2707-23-5) is a chemical compound with the molecular formula C9H7ClF3NO and a molecular weight of 237.60 g/mol. IUPAC name: 2-chloro-N-[4-(trifluoromethyl)phenyl]acetamide. InChIKey: BHXKHTOSJBCCMU-UHFFFAOYSA-N.
| Molecular formula | C9H7ClF3NO |
|---|---|
| Molecular weight | 237.60 g/mol |
| IUPAC name | 2-chloro-N-[4-(trifluoromethyl)phenyl]acetamide |
| InChIKey | BHXKHTOSJBCCMU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(F)(F)F)NC(=O)CCl |
Computed by PubChem (NCBI)