N-(Cyclohexylmethyl)-4'-fluoro-N-methyl-3-(methylsulfonyl)-2'-(methylthio)-[1,1'-biphenyl]-4-carboxamide, 98%
cas: 3055558-98-7 — see every product listed under this CAS number, including other names
N-(Cyclohexylmethyl)-4'-fluoro-N-methyl-3-(methylsulfonyl)-2'-(methylthio)-[1,1'-biphenyl]-4-carboxamide, 98% (CAS 3055558-98-7) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 1mg. Offered by: Chemat, BLDpharm.
| brand | Chemat |
|---|---|
| catalog number | Ch1F2DC1-5mg |
| cas | 3055558-98-7 |
| size | 5mg |
| availability | 0.113g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 5mg | 909.20 Pln | |
| Chemat | 10mg | 1418.00 Pln | |
| Chemat | 25mg | 2642.00 Pln | |
| Chemat | 50mg | 3928.40 Pln | |
| Chemat | 100mg | 5666.00 Pln | |
| BLDpharm | 1mg | 647.57 Pln | |
| BLDpharm | 5mg | 1536.15 Pln | |
| BLDpharm | 10mg | 2413.62 Pln | |
| BLDpharm | 25mg | 4529.54 Pln | |
| BLDpharm | 50mg | 6762.09 Pln | |
| BLDpharm | 100mg | 9772.14 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
N-(cyclohexylmethyl)-4-(4-fluoro-2-methylsulfanylphenyl)-N-methyl-2-methylsulfonylbenzamide (CAS 3055558-98-7) is a chemical compound with the molecular formula C23H28FNO3S2 and a molecular weight of 449.6 g/mol. IUPAC name: N-(cyclohexylmethyl)-4-(4-fluoro-2-methylsulfanylphenyl)-N-methyl-2-methylsulfonylbenzamide. InChIKey: MEFAYSLODGHXPL-UHFFFAOYSA-N.
| Molecular formula | C23H28FNO3S2 |
|---|---|
| Molecular weight | 449.6 g/mol |
| IUPAC name | N-(cyclohexylmethyl)-4-(4-fluoro-2-methylsulfanylphenyl)-N-methyl-2-methylsulfonylbenzamide |
| InChIKey | MEFAYSLODGHXPL-UHFFFAOYSA-N |
| SMILES | CN(CC1CCCCC1)C(=O)C2=C(C=C(C=C2)C3=C(C=C(C=C3)F)SC)S(=O)(=O)C |
Computed by PubChem (NCBI)
Synonyms:
orb2945418