cas: 648905-63-9 — see every product listed under this CAS number, including other names
N-(tert-Butyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide 98% (CAS 648905-63-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A632747-250mg |
| cas | 648905-63-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 320.31 Pln | |
| Ambeed | 5g | 820.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A632747 |
N-tert-butyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide (CAS 648905-63-9) is a chemical compound with the molecular formula C16H26BNO4S and a molecular weight of 339.3 g/mol. IUPAC name: N-tert-butyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide. InChIKey: NUVAQUSOEGIPTR-UHFFFAOYSA-N.
| Molecular formula | C16H26BNO4S |
|---|---|
| Molecular weight | 339.3 g/mol |
| IUPAC name | N-tert-butyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide |
| InChIKey | NUVAQUSOEGIPTR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)S(=O)(=O)NC(C)(C)C |
Computed by PubChem (NCBI)