cas: 874298-88-1 — see every product listed under this CAS number, including other names
N-[(4-chlorophenyl)methyl]-N'-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]Urea, 95%, 95% (CAS 874298-88-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IEKC-100mg |
| cas | 874298-88-1 |
| size | 100mg |
| availability | 8.3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 338.00 Pln | |
| Chemat | 250mg | 611.60 Pln | |
| Chemat | 1g | 1614.80 Pln | |
| Chemat | 5g | 4749.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-[(4-chlorophenyl)methyl]-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea (CAS 874298-88-1) is a chemical compound with the molecular formula C20H24BClN2O3 and a molecular weight of 386.7 g/mol. IUPAC name: 1-[(4-chlorophenyl)methyl]-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea. InChIKey: CYCUGWYASZIAIO-UHFFFAOYSA-N.
| Molecular formula | C20H24BClN2O3 |
|---|---|
| Molecular weight | 386.7 g/mol |
| IUPAC name | 1-[(4-chlorophenyl)methyl]-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea |
| InChIKey | CYCUGWYASZIAIO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)NC(=O)NCC3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)