cas: 944283-09-4 — see every product listed under this CAS number, including other names
N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-leucine 2-carboxy-2-[[(1,1-dimethylethoxy)carbonyl]amino]ethyl ester, ≥95%, ≥95% (CAS 944283-09-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12E0M1-1g |
| cas | 944283-09-4 |
| size | 1g |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 443.60 Pln | |
| Chemat | 5g | 1538.00 Pln | |
| Chemat | 10g | 2594.00 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
(2S)-3-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylpentanoyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 944283-09-4) is a chemical compound with the molecular formula C29H36N2O8 and a molecular weight of 540.6 g/mol. IUPAC name: (2S)-3-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylpentanoyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: ZBFDFHFWCCHHIV-ZEQRLZLVSA-N.
| Molecular formula | C29H36N2O8 |
|---|---|
| Molecular weight | 540.6 g/mol |
| IUPAC name | (2S)-3-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylpentanoyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | ZBFDFHFWCCHHIV-ZEQRLZLVSA-N |
| SMILES | CC(C)C[C@@H](C(=O)OC[C@@H](C(=O)O)NC(=O)OC(C)(C)C)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)