cas: 787591-39-3 — see every product listed under this CAS number, including other names
N-[2-(morpholin-4-yl)ethyl]-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide, 97%, 97% (CAS 787591-39-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116PJT-100mg |
| cas | 787591-39-3 |
| size | 100mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 136.40 Pln | |
| Chemat | 250mg | 179.60 Pln | |
| Chemat | 1g | 309.20 Pln | |
| Chemat | 5g | 1288.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
N-(2-morpholin-4-ylethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (CAS 787591-39-3) is a chemical compound with the molecular formula C19H29BN2O4 and a molecular weight of 360.3 g/mol. IUPAC name: N-(2-morpholin-4-ylethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide. InChIKey: VPNFEKQPSDUJOG-UHFFFAOYSA-N.
| Molecular formula | C19H29BN2O4 |
|---|---|
| Molecular weight | 360.3 g/mol |
| IUPAC name | N-(2-morpholin-4-ylethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| InChIKey | VPNFEKQPSDUJOG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C(=O)NCCN3CCOCC3 |
Computed by PubChem (NCBI)