cas: 1330596-14-9 — see every product listed under this CAS number, including other names
N-[3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-Benzamide, 98% (CAS 1330596-14-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F614503-100MG |
| cas | 1330596-14-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 195.78 Pln | |
| Fluorochem | 250mg | 346.77 Pln | |
| Fluorochem | 1g | 846.59 Pln | |
| Fluorochem | 5g | 4001.73 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzamide (CAS 1330596-14-9) is a chemical compound with the molecular formula C19H22BNO3 and a molecular weight of 323.2 g/mol. IUPAC name: N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzamide. InChIKey: YRVJWHIVVDYOFP-UHFFFAOYSA-N.
| Molecular formula | C19H22BNO3 |
|---|---|
| Molecular weight | 323.2 g/mol |
| IUPAC name | N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzamide |
| InChIKey | YRVJWHIVVDYOFP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)NC(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)