cas: 926191-58-4 — see every product listed under this CAS number, including other names
N-{(2-(aminomethyl)phenyl)methyl}-N-methylcyclohexanamine, 95% (CAS 926191-58-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1111332-10g |
| cas | 926191-58-4 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 17842.30 Pln | |
| AmBeed | 5g | 11495.05 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
N-[[2-(aminomethyl)phenyl]methyl]-N-methylcyclohexanamine (CAS 926191-58-4) is a chemical compound with the molecular formula C15H24N2 and a molecular weight of 232.36 g/mol. IUPAC name: N-[[2-(aminomethyl)phenyl]methyl]-N-methylcyclohexanamine. InChIKey: PJOSCUUJKFLQBZ-UHFFFAOYSA-N.
| Molecular formula | C15H24N2 |
|---|---|
| Molecular weight | 232.36 g/mol |
| IUPAC name | N-[[2-(aminomethyl)phenyl]methyl]-N-methylcyclohexanamine |
| InChIKey | PJOSCUUJKFLQBZ-UHFFFAOYSA-N |
| SMILES | CN(CC1=CC=CC=C1CN)C2CCCCC2 |
Computed by PubChem (NCBI)