cas: 380151-99-5 — see every product listed under this CAS number, including other names
N-Benzyl-3-(4,4,5,5-Tetramethyl-1,3,2-Dioxaborolan-2-Yl)Aniline, 95%, 95% (CAS 380151-99-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12EHYH-250mg |
| cas | 380151-99-5 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 611.60 Pln | |
| Chemat | 1g | 1235.60 Pln | |
| Chemat | 5g | 3165.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
N-benzyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (CAS 380151-99-5) is a chemical compound with the molecular formula C19H24BNO2 and a molecular weight of 309.2 g/mol. IUPAC name: N-benzyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline. InChIKey: WAGWJZGRZKBLHO-UHFFFAOYSA-N.
| Molecular formula | C19H24BNO2 |
|---|---|
| Molecular weight | 309.2 g/mol |
| IUPAC name | N-benzyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| InChIKey | WAGWJZGRZKBLHO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)NCC3=CC=CC=C3 |
Computed by PubChem (NCBI)