cas: 14813-01-5 — see every product listed under this CAS number, including other names
N-Benzyl-3-hydroxypiperidine 98% (CAS 14813-01-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A434216-1g |
| cas | 14813-01-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 192.38 Pln | |
| Ambeed | 10g | 248.00 Pln | |
| Ambeed | 25g | 309.19 Pln | |
| Ambeed | 100g | 693.00 Pln | |
| Ambeed | 500g | 2072.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A434216 |
1-benzylpiperidin-3-ol (CAS 14813-01-5) is a chemical compound with the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. IUPAC name: 1-benzylpiperidin-3-ol. InChIKey: UTTCOAGPVHRUFO-UHFFFAOYSA-N.
| Molecular formula | C12H17NO |
|---|---|
| Molecular weight | 191.27 g/mol |
| IUPAC name | 1-benzylpiperidin-3-ol |
| InChIKey | UTTCOAGPVHRUFO-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)CC2=CC=CC=C2)O |
Computed by PubChem (NCBI)