cas: 1073353-57-7 — see every product listed under this CAS number, including other names
N-Benzyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (CAS 1073353-57-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F228473-1G |
| cas | 1073353-57-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1226.67 Pln | |
| Fluorochem | 5g | 3533.15 Pln |
| delivery time | 3-4 weeks |
|---|
N-benzyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (CAS 1073353-57-7) is a chemical compound with the molecular formula C20H24BNO3 and a molecular weight of 337.2 g/mol. IUPAC name: N-benzyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide. InChIKey: VAFYISMQZLEYKR-UHFFFAOYSA-N.
| Molecular formula | C20H24BNO3 |
|---|---|
| Molecular weight | 337.2 g/mol |
| IUPAC name | N-benzyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| InChIKey | VAFYISMQZLEYKR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C(=O)NCC3=CC=CC=C3 |
Computed by PubChem (NCBI)