cas: 183793-49-9 — see every product listed under this CAS number, including other names
N-Boc-(R)-2-amino-3-methoxy-1-propanol, 98%, 98% (CAS 183793-49-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AWIN-100mg |
| cas | 183793-49-9 |
| size | 100mg |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 1g | 146.00 Pln | |
| Chemat | 5g | 472.40 Pln | |
| Chemat | 25g | 1979.60 Pln | |
| Chemat | 100g | 6198.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[(2R)-1-hydroxy-3-methoxypropan-2-yl]carbamate (CAS 183793-49-9) is a chemical compound with the molecular formula C9H19NO4 and a molecular weight of 205.25 g/mol. IUPAC name: tert-butyl N-[(2R)-1-hydroxy-3-methoxypropan-2-yl]carbamate. InChIKey: CMWJWKLWQJMPMM-SSDOTTSWSA-N.
| Molecular formula | C9H19NO4 |
|---|---|
| Molecular weight | 205.25 g/mol |
| IUPAC name | tert-butyl N-[(2R)-1-hydroxy-3-methoxypropan-2-yl]carbamate |
| InChIKey | CMWJWKLWQJMPMM-SSDOTTSWSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CO)COC |
Computed by PubChem (NCBI)