cas: 286961-14-6 — see every product listed under this CAS number, including other names
N-Boc-1,2,5,6-Tetrahydropyridine-4-Boronic Acid Pinacol Ester, 98%, 98% (CAS 286961-14-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1146CD-1g |
| cas | 286961-14-6 |
| size | 1g |
| availability | 5000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 83.60 Pln | |
| Chemat | 10g | 102.80 Pln | |
| Chemat | 25g | 155.60 Pln | |
| Chemat | 50g | 246.80 Pln | |
| Chemat | 100g | 410.00 Pln | |
| Chemat | 250g | 933.20 Pln | |
| Chemat | 500g | 1852.80 Pln | |
| Chemat | 1kg | 3558.80 Pln | |
| Chemat | 5kg | 12278.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyridine-1-carboxylate (CAS 286961-14-6) is a chemical compound with the molecular formula C16H28BNO4 and a molecular weight of 309.2 g/mol. IUPAC name: tert-butyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyridine-1-carboxylate. InChIKey: VVDCRJGWILREQH-UHFFFAOYSA-N.
| Molecular formula | C16H28BNO4 |
|---|---|
| Molecular weight | 309.2 g/mol |
| IUPAC name | tert-butyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyridine-1-carboxylate |
| InChIKey | VVDCRJGWILREQH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CCN(CC2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)