N-Boc-2-Amino-5-bromo[1,3,4]thiadiazole, 95%
cas: 1048358-33-3 — see every product listed under this CAS number, including other names
N-Boc-2-Amino-5-bromo[1,3,4]thiadiazole, 95% (CAS 1048358-33-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 100mg. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F077102-250MG |
| cas | 1048358-33-3 |
| size | 250mg |
| availability | In Stock Germany |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 133.30 Pln | |
| Fluorochem | 1g | 227.02 Pln | |
| Fluorochem | 5g | 638.33 Pln | |
| Fluorochem | 10g | 1205.84 Pln | |
| Fluorochem | 25g | 2215.90 Pln | |
| Fluorochem | 100g | 6865.31 Pln | |
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 107.60 Pln | |
| Chemat | 1g | 184.40 Pln | |
| Chemat | 5g | 510.80 Pln | |
| Chemat | 10g | 794.00 Pln | |
| Chemat | 25g | 1298.00 Pln | |
| Chemat | 100g | 4605.20 Pln |
properties
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
Tert-butyl N-(5-bromo-1,3,4-thiadiazol-2-yl)carbamate (CAS 1048358-33-3) is a chemical compound with the molecular formula C7H10BrN3O2S and a molecular weight of 280.14 g/mol. IUPAC name: tert-butyl N-(5-bromo-1,3,4-thiadiazol-2-yl)carbamate. InChIKey: FVENMKPZBGIYPA-UHFFFAOYSA-N.
| Molecular formula | C7H10BrN3O2S |
|---|---|
| Molecular weight | 280.14 g/mol |
| IUPAC name | tert-butyl N-(5-bromo-1,3,4-thiadiazol-2-yl)carbamate |
| InChIKey | FVENMKPZBGIYPA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=NN=C(S1)Br |
Computed by PubChem (NCBI)