cas: 883231-23-0 — see every product listed under this CAS number, including other names
N-Boc-2-Amino-5-bromopyrimidine, 97%, 97% (CAS 883231-23-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1190WR-250mg |
| cas | 883231-23-0 |
| size | 250mg |
| availability | 125.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 102.80 Pln | |
| Chemat | 5g | 194.00 Pln | |
| Chemat | 10g | 294.80 Pln | |
| Chemat | 25g | 640.40 Pln | |
| Chemat | 100g | 2344.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-(5-bromopyrimidin-2-yl)carbamate (CAS 883231-23-0) is a chemical compound with the molecular formula C9H12BrN3O2 and a molecular weight of 274.11 g/mol. IUPAC name: tert-butyl N-(5-bromopyrimidin-2-yl)carbamate. InChIKey: MQQCCIJHZDEZBW-UHFFFAOYSA-N.
| Molecular formula | C9H12BrN3O2 |
|---|---|
| Molecular weight | 274.11 g/mol |
| IUPAC name | tert-butyl N-(5-bromopyrimidin-2-yl)carbamate |
| InChIKey | MQQCCIJHZDEZBW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=NC=C(C=N1)Br |
Computed by PubChem (NCBI)