cas: 218594-02-6 — see every product listed under this CAS number, including other names
N-Boc-2-Morpholinecarbaldehyde, 97% (CAS 218594-02-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g, 10g, 250mg, 500mg. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A208791-5g |
| cas | 218594-02-6 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 18603.97 Pln | |
| AmBeed | 1g | 5994.10 Pln | |
| AmBeed | 10g | 27574.75 Pln | |
| Fluorochem | 250mg | 1695.25 Pln | |
| Fluorochem | 500mg | 2569.95 Pln | |
| Fluorochem | 1g | 4038.18 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
Tert-butyl 2-formylmorpholine-4-carboxylate (CAS 218594-02-6) is a chemical compound with the molecular formula C10H17NO4 and a molecular weight of 215.25 g/mol. IUPAC name: tert-butyl 2-formylmorpholine-4-carboxylate. InChIKey: LWKMTSRRGUVABD-UHFFFAOYSA-N.
| Molecular formula | C10H17NO4 |
|---|---|
| Molecular weight | 215.25 g/mol |
| IUPAC name | tert-butyl 2-formylmorpholine-4-carboxylate |
| InChIKey | LWKMTSRRGUVABD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCOC(C1)C=O |
Computed by PubChem (NCBI)