cas: 518047-40-0 — see every product listed under this CAS number, including other names
N-Boc-3-Cyanomorpholine, 98% (CAS 518047-40-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F221704-100MG |
| cas | 518047-40-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 122.89 Pln | |
| Fluorochem | 250mg | 206.20 Pln | |
| Fluorochem | 1g | 659.16 Pln | |
| Fluorochem | 5g | 3074.98 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 3-cyanomorpholine-4-carboxylate (CAS 518047-40-0) is a chemical compound with the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. IUPAC name: tert-butyl 3-cyanomorpholine-4-carboxylate. InChIKey: QSBSEJKNKHZYKD-UHFFFAOYSA-N.
| Molecular formula | C10H16N2O3 |
|---|---|
| Molecular weight | 212.25 g/mol |
| IUPAC name | tert-butyl 3-cyanomorpholine-4-carboxylate |
| InChIKey | QSBSEJKNKHZYKD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCOCC1C#N |
Computed by PubChem (NCBI)