cas: 89151-45-1 — see every product listed under this CAS number, including other names
N-Boc-4-[2-(4-Toluenesulfonyloxy)ethyl]piperidine, 98% (CAS 89151-45-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F077139-250MG |
| cas | 89151-45-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 232.23 Pln | |
| Fluorochem | 1g | 570.65 Pln | |
| Fluorochem | 5g | 1861.86 Pln | |
| Fluorochem | 10g | 2684.49 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 4-[2-(4-methylphenyl)sulfonyloxyethyl]piperidine-1-carboxylate (CAS 89151-45-1) is a chemical compound with the molecular formula C19H29NO5S and a molecular weight of 383.5 g/mol. IUPAC name: tert-butyl 4-[2-(4-methylphenyl)sulfonyloxyethyl]piperidine-1-carboxylate. InChIKey: HHUVXSXDFBEVET-UHFFFAOYSA-N.
| Molecular formula | C19H29NO5S |
|---|---|
| Molecular weight | 383.5 g/mol |
| IUPAC name | tert-butyl 4-[2-(4-methylphenyl)sulfonyloxyethyl]piperidine-1-carboxylate |
| InChIKey | HHUVXSXDFBEVET-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCC2CCN(CC2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)