cas: 209958-42-9 — see every product listed under this CAS number, including other names
N-Boc-4-Bromo-2-fluoro-aniline, 98% (CAS 209958-42-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F041146-1G |
| cas | 209958-42-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 154.13 Pln | |
| Fluorochem | 5g | 294.71 Pln | |
| Fluorochem | 10g | 539.41 Pln | |
| Fluorochem | 25g | 825.77 Pln | |
| Fluorochem | 100g | 3153.07 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-(4-bromo-2-fluorophenyl)carbamate (CAS 209958-42-9) is a chemical compound with the molecular formula C11H13BrFNO2 and a molecular weight of 290.13 g/mol. IUPAC name: tert-butyl N-(4-bromo-2-fluorophenyl)carbamate. InChIKey: DMHILFAMOKMHSO-UHFFFAOYSA-N.
| Molecular formula | C11H13BrFNO2 |
|---|---|
| Molecular weight | 290.13 g/mol |
| IUPAC name | tert-butyl N-(4-bromo-2-fluorophenyl)carbamate |
| InChIKey | DMHILFAMOKMHSO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C=C(C=C1)Br)F |
Computed by PubChem (NCBI)