cas: 352359-22-9 — see every product listed under this CAS number, including other names
N-Boc-6-Chloro-1H-indol-2-ylboronic acid, 98%, 98% (CAS 352359-22-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C1Y2-250mg |
| cas | 352359-22-9 |
| size | 250mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 165.20 Pln | |
| Chemat | 5g | 438.80 Pln | |
| Chemat | 25g | 1950.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
[6-chloro-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid (CAS 352359-22-9) is a chemical compound with the molecular formula C13H15BClNO4 and a molecular weight of 295.53 g/mol. IUPAC name: [6-chloro-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid. InChIKey: AHUWHEZTYPWOCY-UHFFFAOYSA-N.
| Molecular formula | C13H15BClNO4 |
|---|---|
| Molecular weight | 295.53 g/mol |
| IUPAC name | [6-chloro-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid |
| InChIKey | AHUWHEZTYPWOCY-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(N1C(=O)OC(C)(C)C)C=C(C=C2)Cl)(O)O |
Computed by PubChem (NCBI)