cas: 73365-02-3 — see every product listed under this CAS number, including other names
N-Boc-D-Prolinal 97% (CAS 73365-02-3) is a chemical reagent available from Chemat. Available pack sizes: 1000g, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A126248-1000g |
| cas | 73365-02-3 |
| size | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1000g | 10622.06 Pln | |
| Ambeed | 1g | 142.31 Pln | |
| Ambeed | 5g | 159.00 Pln | |
| Ambeed | 10g | 242.44 Pln | |
| Ambeed | 25g | 498.31 Pln | |
| Ambeed | 100g | 1783.25 Pln | |
| Ambeed | 500g | 6661.56 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A126248 |
Tert-butyl (2R)-2-formylpyrrolidine-1-carboxylate (CAS 73365-02-3) is a chemical compound with the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. IUPAC name: tert-butyl (2R)-2-formylpyrrolidine-1-carboxylate. InChIKey: YDBPZCVWPFMBDH-MRVPVSSYSA-N.
| Molecular formula | C10H17NO3 |
|---|---|
| Molecular weight | 199.25 g/mol |
| IUPAC name | tert-butyl (2R)-2-formylpyrrolidine-1-carboxylate |
| InChIKey | YDBPZCVWPFMBDH-MRVPVSSYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H]1C=O |
Computed by PubChem (NCBI)