cas: 66605-57-0 — see every product listed under this CAS number, including other names
N-Boc-L-Phenylalaninol, 98%, 98% (CAS 66605-57-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1147TS-1g |
| cas | 66605-57-0 |
| size | 1g |
| availability | 2000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 69.20 Pln | |
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 78.80 Pln | |
| Chemat | 25g | 93.20 Pln | |
| Chemat | 100g | 179.60 Pln | |
| Chemat | 500g | 729.60 Pln | |
| Chemat | 1kg | 1134.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[(2S)-1-hydroxy-3-phenylpropan-2-yl]carbamate (CAS 66605-57-0) is a chemical compound with the molecular formula C14H21NO3 and a molecular weight of 251.32 g/mol. IUPAC name: tert-butyl N-[(2S)-1-hydroxy-3-phenylpropan-2-yl]carbamate. InChIKey: LDKDMDVMMCXTMO-LBPRGKRZSA-N.
| Molecular formula | C14H21NO3 |
|---|---|
| Molecular weight | 251.32 g/mol |
| IUPAC name | tert-butyl N-[(2S)-1-hydroxy-3-phenylpropan-2-yl]carbamate |
| InChIKey | LDKDMDVMMCXTMO-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC=CC=C1)CO |
Computed by PubChem (NCBI)