cas: 1392499-32-9 — see every product listed under this CAS number, including other names
N-Boc-peg4-bromide, 98%, 98% (CAS 1392499-32-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch120EFV-100mg |
| cas | 1392499-32-9 |
| size | 100mg |
| availability | 500g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 1g | 222.80 Pln | |
| Chemat | 5g | 750.80 Pln | |
| Chemat | 10g | 1302.80 Pln | |
| Chemat | 25g | 2541.20 Pln | |
| Chemat | 50g | 4197.20 Pln | |
| Chemat | 100g | 6952.40 Pln | |
| Chemat | 250g | 14085.20 Pln | |
| Chemat | 500g | 23755.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[2-[2-[2-[2-(2-bromoethoxy)ethoxy]ethoxy]ethoxy]ethyl]carbamate (CAS 1392499-32-9) is a chemical compound with the molecular formula C15H30BrNO6 and a molecular weight of 400.31 g/mol. IUPAC name: tert-butyl N-[2-[2-[2-[2-(2-bromoethoxy)ethoxy]ethoxy]ethoxy]ethyl]carbamate. InChIKey: KYOVSWOWVSWAII-UHFFFAOYSA-N.
| Molecular formula | C15H30BrNO6 |
|---|---|
| Molecular weight | 400.31 g/mol |
| IUPAC name | tert-butyl N-[2-[2-[2-[2-(2-bromoethoxy)ethoxy]ethoxy]ethoxy]ethyl]carbamate |
| InChIKey | KYOVSWOWVSWAII-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCOCCOCCBr |
Computed by PubChem (NCBI)