cas: 1218791-22-0 — see every product listed under this CAS number, including other names
N-Butyl-2-nitro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline 98% (CAS 1218791-22-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A478253-250mg |
| cas | 1218791-22-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 381.50 Pln | |
| Ambeed | 5g | 1010.06 Pln | |
| Ambeed | 25g | 2584.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A478253 |
N-butyl-2-nitro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (CAS 1218791-22-0) is a chemical compound with the molecular formula C16H25BN2O4 and a molecular weight of 320.2 g/mol. IUPAC name: N-butyl-2-nitro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline. InChIKey: UVKYLDTXFMBULW-UHFFFAOYSA-N.
| Molecular formula | C16H25BN2O4 |
|---|---|
| Molecular weight | 320.2 g/mol |
| IUPAC name | N-butyl-2-nitro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| InChIKey | UVKYLDTXFMBULW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)NCCCC)[N+](=O)[O-] |
Computed by PubChem (NCBI)