cas: 201478-72-0 — see every product listed under this CAS number, including other names
N-Cbz-3-piperidinylcarboxaldehyde, 98%, 98% (CAS 201478-72-0) is a chemical reagent available from Chemat. Available pack sizes: 25g, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113DFZ-25g |
| cas | 201478-72-0 |
| size | 25g |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25g | 4634.00 Pln | |
| Chemat | 250mg | 198.80 Pln | |
| Chemat | 1g | 424.40 Pln | |
| Chemat | 5g | 1331.60 Pln | |
| Chemat | 10g | 2349.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Benzyl 3-formylpiperidine-1-carboxylate (CAS 201478-72-0) is a chemical compound with the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. IUPAC name: benzyl 3-formylpiperidine-1-carboxylate. InChIKey: QKGTVOXHDCVOAW-UHFFFAOYSA-N.
| Molecular formula | C14H17NO3 |
|---|---|
| Molecular weight | 247.29 g/mol |
| IUPAC name | benzyl 3-formylpiperidine-1-carboxylate |
| InChIKey | QKGTVOXHDCVOAW-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)C(=O)OCC2=CC=CC=C2)C=O |
Computed by PubChem (NCBI)