cas: 149423-77-8 — see every product listed under this CAS number, including other names
N-Cbz-trans-1,4-cyclohexanediamine, 99% (CAS 149423-77-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F040927-100MG |
| cas | 149423-77-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 174.96 Pln | |
| Fluorochem | 250mg | 221.81 Pln | |
| Fluorochem | 1g | 534.20 Pln | |
| Fluorochem | 5g | 1408.90 Pln |
| purity | 99% |
|---|---|
| delivery time | 3-4 weeks |
Benzyl N-(4-aminocyclohexyl)carbamate (CAS 149423-77-8) is a chemical compound with the molecular formula C14H20N2O2 and a molecular weight of 248.32 g/mol. IUPAC name: benzyl N-(4-aminocyclohexyl)carbamate. InChIKey: JQVBZZUMWRXDSQ-UHFFFAOYSA-N.
| Molecular formula | C14H20N2O2 |
|---|---|
| Molecular weight | 248.32 g/mol |
| IUPAC name | benzyl N-(4-aminocyclohexyl)carbamate |
| InChIKey | JQVBZZUMWRXDSQ-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1N)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)