cas: 64204-55-3 — see every product listed under this CAS number, including other names
N-Cyclohexyl-2-(piperazin-1-yl)acetamide (CAS 64204-55-3) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EBWP-5mg |
| cas | 64204-55-3 |
| size | 5mg |
| availability | 0.2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5mg | 136.40 Pln | |
| Chemat | 10mg | 174.80 Pln | |
| Chemat | 25mg | 266.00 Pln | |
| Chemat | 50mg | 366.80 Pln | |
| Chemat | 100mg | 530.00 Pln | |
| Chemat | 200mg | 760.40 Pln |
| delivery time | 3 weeks |
|---|
N-cyclohexyl-2-piperazin-1-ylacetamide (CAS 64204-55-3) is a chemical compound with the molecular formula C12H23N3O and a molecular weight of 225.33 g/mol. IUPAC name: N-cyclohexyl-2-piperazin-1-ylacetamide. InChIKey: RTFADALJKSFJDZ-UHFFFAOYSA-N.
| Molecular formula | C12H23N3O |
|---|---|
| Molecular weight | 225.33 g/mol |
| IUPAC name | N-cyclohexyl-2-piperazin-1-ylacetamide |
| InChIKey | RTFADALJKSFJDZ-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)NC(=O)CN2CCNCC2 |
Computed by PubChem (NCBI)