cas: 794539-14-3 — see every product listed under this CAS number, including other names
N-Cyclopropyl-4-iodobenzamide, 98%, 98% (CAS 794539-14-3) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ID2F-50mg |
| cas | 794539-14-3 |
| size | 50mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 146.00 Pln | |
| Chemat | 100mg | 189.20 Pln | |
| Chemat | 250mg | 251.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
N-cyclopropyl-4-iodobenzamide (CAS 794539-14-3) is a chemical compound with the molecular formula C10H10INO and a molecular weight of 287.10 g/mol. IUPAC name: N-cyclopropyl-4-iodobenzamide. InChIKey: PZYDJAWERUKJRG-UHFFFAOYSA-N.
| Molecular formula | C10H10INO |
|---|---|
| Molecular weight | 287.10 g/mol |
| IUPAC name | N-cyclopropyl-4-iodobenzamide |
| InChIKey | PZYDJAWERUKJRG-UHFFFAOYSA-N |
| SMILES | C1CC1NC(=O)C2=CC=C(C=C2)I |
Computed by PubChem (NCBI)