cas: 1218789-33-3 — see every product listed under this CAS number, including other names
N-Cyclopropyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine, 95%, 95% (CAS 1218789-33-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11277K-100mg |
| cas | 1218789-33-3 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 198.80 Pln | |
| Chemat | 250mg | 294.80 Pln | |
| Chemat | 1g | 683.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
N-cyclopropyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine (CAS 1218789-33-3) is a chemical compound with the molecular formula C13H20BN3O2 and a molecular weight of 261.13 g/mol. IUPAC name: N-cyclopropyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine. InChIKey: QNCUDGRKLRQDMW-UHFFFAOYSA-N.
| Molecular formula | C13H20BN3O2 |
|---|---|
| Molecular weight | 261.13 g/mol |
| IUPAC name | N-cyclopropyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine |
| InChIKey | QNCUDGRKLRQDMW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(N=C2)NC3CC3 |
Computed by PubChem (NCBI)