cas: 1005500-75-3 — see every product listed under this CAS number, including other names
N-Ethynyl-N,4-dimethylbenzenesulfonamide, 96% (CAS 1005500-75-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F620304-250MG |
| cas | 1005500-75-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 96.86 Pln | |
| Fluorochem | 1g | 133.30 Pln | |
| Fluorochem | 5g | 279.09 Pln | |
| Fluorochem | 25g | 1169.40 Pln | |
| Fluorochem | 100g | 4043.39 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
N-ethynyl-N,4-dimethylbenzenesulfonamide (CAS 1005500-75-3) is a chemical compound with the molecular formula C10H11NO2S and a molecular weight of 209.27 g/mol. IUPAC name: N-ethynyl-N,4-dimethylbenzenesulfonamide. InChIKey: VRNLIJIYOKNEOP-UHFFFAOYSA-N.
| Molecular formula | C10H11NO2S |
|---|---|
| Molecular weight | 209.27 g/mol |
| IUPAC name | N-ethynyl-N,4-dimethylbenzenesulfonamide |
| InChIKey | VRNLIJIYOKNEOP-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N(C)C#C |
Computed by PubChem (NCBI)