cas: 133745-75-2 — see every product listed under this CAS number, including other names
N-Fluorodibenzenesulfonimide, 98%, 98% (CAS 133745-75-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1146DS-1g |
| cas | 133745-75-2 |
| size | 1g |
| availability | 100000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 69.20 Pln | |
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 74.00 Pln | |
| Chemat | 25g | 74.00 Pln | |
| Chemat | 50g | 83.60 Pln | |
| Chemat | 100g | 93.20 Pln | |
| Chemat | 250g | 146.00 Pln | |
| Chemat | 500g | 297.60 Pln | |
| Chemat | 1kg | 506.00 Pln | |
| Chemat | 5kg | 2798.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
N-(benzenesulfonyl)-N-fluorobenzenesulfonamide (CAS 133745-75-2) is a chemical compound with the molecular formula C12H10FNO4S2 and a molecular weight of 315.3 g/mol. IUPAC name: N-(benzenesulfonyl)-N-fluorobenzenesulfonamide. InChIKey: RLKHFSNWQCZBDC-UHFFFAOYSA-N.
| Molecular formula | C12H10FNO4S2 |
|---|---|
| Molecular weight | 315.3 g/mol |
| IUPAC name | N-(benzenesulfonyl)-N-fluorobenzenesulfonamide |
| InChIKey | RLKHFSNWQCZBDC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)N(F)S(=O)(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)