CAS 86060-90-4 appears in our catalog under these names: Fmoc-pro-opfp, 95%, Fmoc-L-proline pentafluorophenyl ester, 95%, Fmoc–Pro–OPfp, N-Fmoc-L-proline pentafluorophenyl ester, 98% , Fmoc-Pro-OPfp, 95.00%. Offered by: Combi-blocks, AmBeed, GLPBio, Thermo Scientific (Alfa Aesar), Chemat. Available pack sizes: 10g, 25g, 5g, 1g, 2g, 100g.
1-O-(9H-fluoren-9-ylmethyl) 2-O-(2,3,4,5,6-pentafluorophenyl) (2S)-pyrrolidine-1,2-dicarboxylate (CAS 86060-90-4) is a chemical compound with the molecular formula C26H18F5NO4 and a molecular weight of 503.4 g/mol. IUPAC name: 1-O-(9H-fluoren-9-ylmethyl) 2-O-(2,3,4,5,6-pentafluorophenyl) (2S)-pyrrolidine-1,2-dicarboxylate. InChIKey: CQBLOHXKGUNWRV-SFHVURJKSA-N.
| Molecular formula | C26H18F5NO4 |
|---|---|
| Molecular weight | 503.4 g/mol |
| IUPAC name | 1-O-(9H-fluoren-9-ylmethyl) 2-O-(2,3,4,5,6-pentafluorophenyl) (2S)-pyrrolidine-1,2-dicarboxylate |
| InChIKey | CQBLOHXKGUNWRV-SFHVURJKSA-N |
| SMILES | C1C[C@H](N(C1)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)OC5=C(C(=C(C(=C5F)F)F)F)F |
Computed by PubChem (NCBI)