cas: 200623-62-7 — see every product listed under this CAS number, including other names
N-Fmoc-N’-trityl-D-glutamine, 98%, 98% (CAS 200623-62-7) is a chemical reagent available from Chemat. Available pack sizes: 50g, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113CV7-50g |
| cas | 200623-62-7 |
| size | 50g |
| availability | 130g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 50g | 1000.40 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 98.00 Pln | |
| Chemat | 5g | 174.80 Pln | |
| Chemat | 10g | 275.60 Pln | |
| Chemat | 25g | 534.80 Pln | |
| Chemat | 100g | 1941.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxo-5-(tritylamino)pentanoic acid (CAS 200623-62-7) is a chemical compound with the molecular formula C39H34N2O5 and a molecular weight of 610.7 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxo-5-(tritylamino)pentanoic acid. InChIKey: WDGICUODAOGOMO-PGUFJCEWSA-N.
| Molecular formula | C39H34N2O5 |
|---|---|
| Molecular weight | 610.7 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxo-5-(tritylamino)pentanoic acid |
| InChIKey | WDGICUODAOGOMO-PGUFJCEWSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)NC(=O)CC[C@H](C(=O)O)NC(=O)OCC4C5=CC=CC=C5C6=CC=CC=C46 |
Computed by PubChem (NCBI)