CAS 1351611-14-7 appears in our catalog under these names: Apixaban Impurity 34, Apixaban Imprity 19, Apixaban Impurity 10, N-Formyl Apixaban, APIXABAN RELATED COMPOUND D. Offered by: Chemat Brand, TRC, Biosynth, Sigma-Aldrich, Chemat. Available pack sizes: on request, 100mg, 10mg, 25mg, 15MG, 50mg, 250mg, 1g.
N-formyl-1-(4-methoxyphenyl)-7-oxo-6-[4-(2-oxopiperidin-1-yl)phenyl]-4,5-dihydropyrazolo[5,4-c]pyridine-3-carboxamide (CAS 1351611-14-7) is a chemical compound with the molecular formula C26H25N5O5 and a molecular weight of 487.5 g/mol. IUPAC name: N-formyl-1-(4-methoxyphenyl)-7-oxo-6-[4-(2-oxopiperidin-1-yl)phenyl]-4,5-dihydropyrazolo[5,4-c]pyridine-3-carboxamide. InChIKey: RRAFWRVOUFGSEW-UHFFFAOYSA-N.
| Molecular formula | C26H25N5O5 |
|---|---|
| Molecular weight | 487.5 g/mol |
| IUPAC name | N-formyl-1-(4-methoxyphenyl)-7-oxo-6-[4-(2-oxopiperidin-1-yl)phenyl]-4,5-dihydropyrazolo[5,4-c]pyridine-3-carboxamide |
| InChIKey | RRAFWRVOUFGSEW-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)N2C3=C(CCN(C3=O)C4=CC=C(C=C4)N5CCCCC5=O)C(=N2)C(=O)NC=O |
Computed by PubChem (NCBI)