cas: 32477-35-3 — see every product listed under this CAS number, including other names
N-Heptafluorobutyrylimidazole 98% (CAS 32477-35-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A243894-1g |
| cas | 32477-35-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 214.62 Pln | |
| Ambeed | 25g | 720.81 Pln | |
| Ambeed | 100g | 2250.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A243894 |
2,2,3,3,4,4,4-heptafluoro-1-imidazol-1-ylbutan-1-one (CAS 32477-35-3) is a chemical compound with the molecular formula C7H3F7N2O and a molecular weight of 264.10 g/mol. IUPAC name: 2,2,3,3,4,4,4-heptafluoro-1-imidazol-1-ylbutan-1-one. InChIKey: MSYHGYDAVLDKCE-UHFFFAOYSA-N.
| Molecular formula | C7H3F7N2O |
|---|---|
| Molecular weight | 264.10 g/mol |
| IUPAC name | 2,2,3,3,4,4,4-heptafluoro-1-imidazol-1-ylbutan-1-one |
| InChIKey | MSYHGYDAVLDKCE-UHFFFAOYSA-N |
| SMILES | C1=CN(C=N1)C(=O)C(C(C(F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)