cas: 64037-95-2 — see every product listed under this CAS number, including other names
N-Methyl-1,2,3,4-tetrahydronaphthalen-1-amine hydrochloride 97% (CAS 64037-95-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A703222-100mg |
| cas | 64037-95-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 225.75 Pln | |
| Ambeed | 250mg | 270.25 Pln | |
| Ambeed | 1g | 309.19 Pln | |
| Ambeed | 5g | 1093.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A703222 |
Methyl(1,2,3,4-tetrahydronaphthalen-1-yl)azanium chloride (CAS 64037-95-2) is a chemical compound with the molecular formula C11H16ClN and a molecular weight of 197.70 g/mol. IUPAC name: methyl(1,2,3,4-tetrahydronaphthalen-1-yl)azanium chloride. InChIKey: DXTXXJLZWGNMLO-UHFFFAOYSA-N.
| Molecular formula | C11H16ClN |
|---|---|
| Molecular weight | 197.70 g/mol |
| IUPAC name | methyl(1,2,3,4-tetrahydronaphthalen-1-yl)azanium chloride |
| InChIKey | DXTXXJLZWGNMLO-UHFFFAOYSA-N |
| SMILES | C[NH2+]C1CCCC2=CC=CC=C12.[Cl-] |
Computed by PubChem (NCBI)