cas: 909398-60-3 — see every product listed under this CAS number, including other names
N-Methyl-1-Octylpyrrolidinium Chloride, 95%, 95% (CAS 909398-60-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114T74-1g |
| cas | 909398-60-3 |
| size | 1g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 131.60 Pln | |
| Chemat | 10g | 165.20 Pln | |
| Chemat | 25g | 270.80 Pln | |
| Chemat | 100g | 683.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-methyl-1-octylpyrrolidin-1-ium chloride (CAS 909398-60-3) is a chemical compound with the molecular formula C13H28ClN and a molecular weight of 233.82 g/mol. IUPAC name: 1-methyl-1-octylpyrrolidin-1-ium chloride. InChIKey: LNMCPMPHEHNPRY-UHFFFAOYSA-M.
| Molecular formula | C13H28ClN |
|---|---|
| Molecular weight | 233.82 g/mol |
| IUPAC name | 1-methyl-1-octylpyrrolidin-1-ium chloride |
| InChIKey | LNMCPMPHEHNPRY-UHFFFAOYSA-M |
| SMILES | CCCCCCCC[N+]1(CCCC1)C.[Cl-] |
Computed by PubChem (NCBI)