cas: 1346245-52-0 — see every product listed under this CAS number, including other names
N-Methyl-2-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazol-1-yl)acetamide 95% (CAS 1346245-52-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A921311-100mg |
| cas | 1346245-52-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 253.56 Pln | |
| Ambeed | 250mg | 375.94 Pln | |
| Ambeed | 1g | 715.25 Pln | |
| Ambeed | 5g | 2534.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A921311 |
N-methyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]acetamide (CAS 1346245-52-0) is a chemical compound with the molecular formula C12H20BN3O3 and a molecular weight of 265.12 g/mol. IUPAC name: N-methyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]acetamide. InChIKey: CBACZCQOYFWCOQ-UHFFFAOYSA-N.
| Molecular formula | C12H20BN3O3 |
|---|---|
| Molecular weight | 265.12 g/mol |
| IUPAC name | N-methyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]acetamide |
| InChIKey | CBACZCQOYFWCOQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2)CC(=O)NC |
Computed by PubChem (NCBI)