cas: 1256359-34-8 — see every product listed under this CAS number, including other names
N-Methyl-2-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)acetamide 98% (CAS 1256359-34-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A291879-100mg |
| cas | 1256359-34-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 281.38 Pln | |
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 854.31 Pln | |
| Ambeed | 5g | 2584.25 Pln | |
| Ambeed | 25g | 8869.88 Pln | |
| Ambeed | 100g | 35002.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A291879 |
N-methyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide (CAS 1256359-34-8) is a chemical compound with the molecular formula C15H22BNO3 and a molecular weight of 275.15 g/mol. IUPAC name: N-methyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide. InChIKey: JZQKSRMOFRSRHN-UHFFFAOYSA-N.
| Molecular formula | C15H22BNO3 |
|---|---|
| Molecular weight | 275.15 g/mol |
| IUPAC name | N-methyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide |
| InChIKey | JZQKSRMOFRSRHN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)CC(=O)NC |
Computed by PubChem (NCBI)