cas: 1139453-98-7 — see every product listed under this CAS number, including other names
N-Methyl-2-(4-methylpiperazin-1-yl)-N-(4-nitrophenyl)acetamide, 95%+, 95%+ (CAS 1139453-98-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111A57-1g |
| cas | 1139453-98-7 |
| size | 1g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 117.20 Pln | |
| Chemat | 5g | 285.20 Pln | |
| Chemat | 10g | 453.20 Pln | |
| Chemat | 25g | 818.00 Pln | |
| Chemat | 50g | 1437.20 Pln | |
| Chemat | 100g | 2555.60 Pln |
| purity | 95%+ |
|---|---|
| delivery time | 3 weeks |
N-methyl-2-(4-methylpiperazin-1-yl)-N-(4-nitrophenyl)acetamide (CAS 1139453-98-7) is a chemical compound with the molecular formula C14H20N4O3 and a molecular weight of 292.33 g/mol. IUPAC name: N-methyl-2-(4-methylpiperazin-1-yl)-N-(4-nitrophenyl)acetamide. InChIKey: LSQRHFSGOUDQDS-UHFFFAOYSA-N.
| Molecular formula | C14H20N4O3 |
|---|---|
| Molecular weight | 292.33 g/mol |
| IUPAC name | N-methyl-2-(4-methylpiperazin-1-yl)-N-(4-nitrophenyl)acetamide |
| InChIKey | LSQRHFSGOUDQDS-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)CC(=O)N(C)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)