cas: 956821-93-5 — see every product listed under this CAS number, including other names
N-Methyl-2-nitro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline 98% (CAS 956821-93-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A237121-100mg |
| cas | 956821-93-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 281.38 Pln | |
| Ambeed | 250mg | 353.69 Pln | |
| Ambeed | 1g | 409.31 Pln | |
| Ambeed | 5g | 1482.88 Pln | |
| Ambeed | 25g | 5204.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A237121 |
N-methyl-2-nitro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (CAS 956821-93-5) is a chemical compound with the molecular formula C13H19BN2O4 and a molecular weight of 278.11 g/mol. IUPAC name: N-methyl-2-nitro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline. InChIKey: XTOIYOHQFNGBRM-UHFFFAOYSA-N.
| Molecular formula | C13H19BN2O4 |
|---|---|
| Molecular weight | 278.11 g/mol |
| IUPAC name | N-methyl-2-nitro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| InChIKey | XTOIYOHQFNGBRM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)NC)[N+](=O)[O-] |
Computed by PubChem (NCBI)