cas: 1260431-01-3 — see every product listed under this CAS number, including other names
N-Methyl-N-(t-Boc)-PEG4-acid 95% (CAS 1260431-01-3) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A755664-50mg |
| cas | 1260431-01-3 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 709.69 Pln | |
| Ambeed | 100mg | 1154.69 Pln | |
| Ambeed | 250mg | 1900.06 Pln | |
| Ambeed | 1g | 5003.94 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A755664 |
3-[2-[2-[2-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 1260431-01-3) is a chemical compound with the molecular formula C17H33NO8 and a molecular weight of 379.4 g/mol. IUPAC name: 3-[2-[2-[2-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: SZYFMMNWNDIBGM-UHFFFAOYSA-N.
| Molecular formula | C17H33NO8 |
|---|---|
| Molecular weight | 379.4 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | SZYFMMNWNDIBGM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C)CCOCCOCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)