CAS 1395316-08-1 appears in our catalog under these names: N-Phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide, 97%, 97%, N-Phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 25g, 5g.
N-phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (CAS 1395316-08-1) is a chemical compound with the molecular formula C19H22BNO3 and a molecular weight of 323.2 g/mol. IUPAC name: N-phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide. InChIKey: KANGHEZSXJSOCV-UHFFFAOYSA-N.
| Molecular formula | C19H22BNO3 |
|---|---|
| Molecular weight | 323.2 g/mol |
| IUPAC name | N-phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| InChIKey | KANGHEZSXJSOCV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)C(=O)NC3=CC=CC=C3 |
Computed by PubChem (NCBI)